About N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide
N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide (PubChem CID 12621398) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide |
| PubChem CID | 12621398 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2CC(c3ccncc3)C(C)(C)N2)cc1 |
| InChI | InChI=1S/C19H23N3O/c1-13(23)21-16-6-4-15(5-7-16)18-12-17(19(2,3)22-18)14-8-10-20-11-9-14/h4-11,17-18,22H,12H2,1-3H3,(H,21,23) |
| InChIKey | NDWUCEWCHKHPPH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide?
The IUPAC name of N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide (CID 12621398) is N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide.
What is the SMILES notation for N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide?
The canonical SMILES for N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide is CC(=O)Nc1ccc(C2CC(c3ccncc3)C(C)(C)N2)cc1.
What is the InChIKey of N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide?
The InChIKey is NDWUCEWCHKHPPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O/c1-13(23)21-16-6-4-15(5-7-16)18-12-17(19(2,3)22-18)14-8-10-20-11-9-14/h4-11,17-18,22H,12H2,1-3H3,(H,21,23).
What are the key properties of N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide?
N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide has a molecular weight of 309.41 g/mol, XLogP of 3.64, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5,5-dimethyl-4-pyridin-4-ylpyrrolidin-2-yl)phenyl]acetamide is sourced from PubChem (CID 12621398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).