C21H18N4O7 — CID 126215651
(5E)-5-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 126215651) has the molecular formula C21H18N4O7 and a molecular weight of 438.40 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126215651 |
| Molecular Formula | C21H18N4O7 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylidene]-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)/C(=C\c2ccc(Oc3ccc([N+](=O)[O-])cn3)c(OCC)c2)C1=O |
| InChI | InChI=1S/C21H18N4O7/c1-3-9-24-20(27)15(19(26)23-21(24)28)10-13-5-7-16(17(11-13)31-4-2)32-18-8-6-14(12-22-18)25(29)30/h3,5-8,10-12H,1,4,9H2,2H3,(H,23,26,28)/b15-10+ |
| InChIKey | FMBNBTHNJGEDAQ-XNTDXEJSSA-N |
| XLogP | 2.83 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|