C19H9Cl2N3O5 — CID 126218861
(E)-3-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126218861) has the molecular formula C19H9Cl2N3O5 and a molecular weight of 430.20 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126218861 |
| Molecular Formula | C19H9Cl2N3O5 |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | (E)-3-[5-(2,4-dichloro-5-nitrophenyl)furan-2-yl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(-c2cc([N+](=O)[O-])c(Cl)cc2Cl)o1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H9Cl2N3O5/c20-16-9-17(21)18(24(27)28)8-15(16)19-6-5-14(29-19)7-12(10-22)11-1-3-13(4-2-11)23(25)26/h1-9H/b12-7- |
| InChIKey | RHUVFGHHKDWUCP-GHXNOFRVSA-N |
| XLogP | 6.13 |
| TPSA | 123.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|