About 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one
6-methyl-[1]benzofuro[2,3-b]quinolin-11-one (PubChem CID 12621905) has the molecular formula C16H11NO2
and a molecular weight of 249.27 g/mol. Its IUPAC name is 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one.
Molecular Properties
| Compound Name | 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one |
| PubChem CID | 12621905 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one |
| SMILES | Cn1c2ccccc2c(=O)c2c3ccccc3oc21 |
| InChI | InChI=1S/C16H11NO2/c1-17-12-8-4-2-6-10(12)15(18)14-11-7-3-5-9-13(11)19-16(14)17/h2-9H,1H3 |
| InChIKey | SUNXSUVIYFWRHI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one?
The IUPAC name of 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one (CID 12621905) is 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one.
What is the SMILES notation for 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one?
The canonical SMILES for 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one is Cn1c2ccccc2c(=O)c2c3ccccc3oc21.
What is the InChIKey of 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one?
The InChIKey is SUNXSUVIYFWRHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO2/c1-17-12-8-4-2-6-10(12)15(18)14-11-7-3-5-9-13(11)19-16(14)17/h2-9H,1H3.
What are the key properties of 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one?
6-methyl-[1]benzofuro[2,3-b]quinolin-11-one has a molecular weight of 249.27 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-[1]benzofuro[2,3-b]quinolin-11-one is sourced from PubChem (CID 12621905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).