About 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine
8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine (PubChem CID 12621940) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 12621940 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1ccc(C(C)C)c2c1OCCO2 |
| InChI | InChI=1S/C12H16O2/c1-8(2)10-5-4-9(3)11-12(10)14-7-6-13-11/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | JOOOCNZSKAVSLP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine (CID 12621940) is 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine is Cc1ccc(C(C)C)c2c1OCCO2.
What is the InChIKey of 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine?
The InChIKey is JOOOCNZSKAVSLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-8(2)10-5-4-9(3)11-12(10)14-7-6-13-11/h4-5,8H,6-7H2,1-3H3.
What are the key properties of 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine?
8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine has a molecular weight of 192.26 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-5-propan-2-yl-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 12621940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).