C24H16ClI2NO4S — CID 126219625
(5E)-3-(3-chlorophenyl)-5-[[3-iodo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126219625) has the molecular formula C24H16ClI2NO4S and a molecular weight of 703.72 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[[3-iodo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[[3-iodo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126219625 |
| Molecular Formula | C24H16ClI2NO4S |
| Molecular Weight | 703.72 g/mol |
| Exact Mass | 702.86 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[[3-iodo-4-[(4-iodophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(c3cccc(Cl)c3)C2=O)cc(I)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C24H16ClI2NO4S/c1-31-20-10-15(9-19(27)22(20)32-13-14-5-7-17(26)8-6-14)11-21-23(29)28(24(30)33-21)18-4-2-3-16(25)12-18/h2-12H,13H2,1H3/b21-11+ |
| InChIKey | UTJRKUILZBQPIO-SRZZPIQSSA-N |
| XLogP | 7.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.72 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|