C25H28BrIN2O3S — CID 126220056
(5E)-5-[[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 126220056) has the molecular formula C25H28BrIN2O3S and a molecular weight of 643.38 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126220056 |
| Molecular Formula | C25H28BrIN2O3S |
| Molecular Weight | 643.38 g/mol |
| Exact Mass | 642.00 |
| IUPAC Name | (5E)-5-[[3-bromo-5-ethoxy-4-[(4-iodophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-2-propan-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\C(C)C)N(C(C)C)C2=O)cc(Br)c1OCc1ccc(I)cc1 |
| InChI | InChI=1S/C25H28BrIN2O3S/c1-6-31-21-12-18(11-20(26)23(21)32-14-17-7-9-19(27)10-8-17)13-22-24(30)29(16(4)5)25(33-22)28-15(2)3/h7-13,15-16H,6,14H2,1-5H3/b22-13+,28-25- |
| InChIKey | UXNFXKASWHKYTL-ASCZMWPCSA-N |
| XLogP | 7.12 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.38 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|