C29H25N5O — CID 126222068
4-(methoxymethyl)-6-methyl-2-[(2E)-2-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]hydrazinyl]pyridine-3-carbonitrile (PubChem CID 126222068) has the molecular formula C29H25N5O and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-(methoxymethyl)-6-methyl-2-[(2E)-2-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]hydrazinyl]pyridine-3-carbonitrile.
| Compound Name | 4-(methoxymethyl)-6-methyl-2-[(2E)-2-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]hydrazinyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 126222068 |
| Molecular Formula | C29H25N5O |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 4-(methoxymethyl)-6-methyl-2-[(2E)-2-[[1-(naphthalen-2-ylmethyl)indol-3-yl]methylidene]hydrazinyl]pyridine-3-carbonitrile |
| SMILES | COCc1cc(C)nc(N/N=C/c2cn(Cc3ccc4ccccc4c3)c3ccccc23)c1C#N |
| InChI | InChI=1S/C29H25N5O/c1-20-13-24(19-35-2)27(15-30)29(32-20)33-31-16-25-18-34(28-10-6-5-9-26(25)28)17-21-11-12-22-7-3-4-8-23(22)14-21/h3-14,16,18H,17,19H2,1-2H3,(H,32,33)/b31-16+ |
| InChIKey | BUBWTFQBVKGFPB-WCMJOSRZSA-N |
| XLogP | 6.01 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|