C11H20O2 — CID 12622223
2-(3,4-dimethylpent-4-enyl)-2-methyl-1,3-dioxolane (PubChem CID 12622223) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(3,4-dimethylpent-4-enyl)-2-methyl-1,3-dioxolane.
| Compound Name | 2-(3,4-dimethylpent-4-enyl)-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 12622223 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-(3,4-dimethylpent-4-enyl)-2-methyl-1,3-dioxolane |
| SMILES | C=C(C)C(C)CCC1(C)OCCO1 |
| InChI | InChI=1S/C11H20O2/c1-9(2)10(3)5-6-11(4)12-7-8-13-11/h10H,1,5-8H2,2-4H3 |
| InChIKey | WCOTUGUCWQHNLP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|