About 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane
2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane (PubChem CID 12622224) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane |
| PubChem CID | 12622224 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane |
| SMILES | C=C(C)C(CCCC)CCC1(C)OCCO1 |
| InChI | InChI=1S/C14H26O2/c1-5-6-7-13(12(2)3)8-9-14(4)15-10-11-16-14/h13H,2,5-11H2,1,3-4H3 |
| InChIKey | ZJMXTZYPFKXDSB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane?
The IUPAC name of 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane (CID 12622224) is 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane.
What is the SMILES notation for 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane?
The canonical SMILES for 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane is C=C(C)C(CCCC)CCC1(C)OCCO1.
What is the InChIKey of 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane?
The InChIKey is ZJMXTZYPFKXDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-5-6-7-13(12(2)3)8-9-14(4)15-10-11-16-14/h13H,2,5-11H2,1,3-4H3.
What are the key properties of 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane?
2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane has a molecular weight of 226.36 g/mol, XLogP of 3.91, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(3-prop-1-en-2-ylheptyl)-1,3-dioxolane is sourced from PubChem (CID 12622224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).