About 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine
7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 12622435) has the molecular formula C5H6N4
and a molecular weight of 122.13 g/mol. Its IUPAC name is 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine.
Analyze 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine?
The IUPAC name of 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine (CID 12622435) is 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine.
What is the SMILES notation for 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine?
The canonical SMILES for 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine is C1=Nn2cnnc2CC1.
What is the InChIKey of 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine?
The InChIKey is NFMWAIXSRUDCQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4/c1-2-5-8-6-4-9(5)7-3-1/h3-4H,1-2H2.
What are the key properties of 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine?
7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine has a molecular weight of 122.13 g/mol, XLogP of 0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine is sourced from PubChem (CID 12622435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).