C18H14ClN3O3 — CID 126226619
(E)-3-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 126226619) has the molecular formula C18H14ClN3O3 and a molecular weight of 355.78 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126226619 |
| Molecular Formula | C18H14ClN3O3 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(OCC(N)=O)c(Cl)c1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H14ClN3O3/c19-15-9-12(6-7-16(15)25-11-17(21)23)8-13(10-20)18(24)22-14-4-2-1-3-5-14/h1-9H,11H2,(H2,21,23)(H,22,24)/b13-8+ |
| InChIKey | ZBXFQBSEAIIWJJ-MDWZMJQESA-N |
| XLogP | 2.75 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|