C27H20ClN3O7 — CID 126229360
methyl 4-[(5E)-5-[[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126229360) has the molecular formula C27H20ClN3O7 and a molecular weight of 533.92 g/mol. Its IUPAC name is methyl 4-[(5E)-5-[[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5E)-5-[[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126229360 |
| Molecular Formula | C27H20ClN3O7 |
| Molecular Weight | 533.92 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | methyl 4-[(5E)-5-[[2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C\c3ccccc3OCC(=O)Nc3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H20ClN3O7/c1-37-26(35)16-6-12-20(13-7-16)31-25(34)21(24(33)30-27(31)36)14-17-4-2-3-5-22(17)38-15-23(32)29-19-10-8-18(28)9-11-19/h2-14H,15H2,1H3,(H,29,32)(H,30,33,36)/b21-14+ |
| InChIKey | FGYXVDGQPCEPFJ-KGENOOAVSA-N |
| XLogP | 3.81 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|