C31H27N3O7 — CID 126231109
[2-methoxy-4-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 126231109) has the molecular formula C31H27N3O7 and a molecular weight of 553.57 g/mol. Its IUPAC name is [2-methoxy-4-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-methoxy-4-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126231109 |
| Molecular Formula | C31H27N3O7 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | [2-methoxy-4-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C=NNC(=O)c3cccc(NC(=O)c4cccc(OC)c4)c3)cc2OC)cc1 |
| InChI | InChI=1S/C31H27N3O7/c1-38-25-13-11-21(12-14-25)31(37)41-27-15-10-20(16-28(27)40-3)19-32-34-30(36)22-6-4-8-24(17-22)33-29(35)23-7-5-9-26(18-23)39-2/h4-19H,1-3H3,(H,33,35)(H,34,36) |
| InChIKey | NOMQDXUKWFUPFY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|