C24H32N8O — CID 126231131
(3Z)-3-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]-1-ethylindol-2-one (PubChem CID 126231131) has the molecular formula C24H32N8O and a molecular weight of 448.58 g/mol. Its IUPAC name is (3Z)-3-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]-1-ethylindol-2-one.
| Compound Name | (3Z)-3-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 126231131 |
| Molecular Formula | C24H32N8O |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | (3Z)-3-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]-methylhydrazinylidene]-1-ethylindol-2-one |
| SMILES | CCN1C(=O)/C(=N\N(C)c2nc(N3CCCCC3)nc(N3CCCCC3)n2)c2ccccc21 |
| InChI | InChI=1S/C24H32N8O/c1-3-32-19-13-7-6-12-18(19)20(21(32)33)28-29(2)22-25-23(30-14-8-4-9-15-30)27-24(26-22)31-16-10-5-11-17-31/h6-7,12-13H,3-5,8-11,14-17H2,1-2H3/b28-20- |
| InChIKey | NZXSPWGXQKZJBK-RRAHZORUSA-N |
| XLogP | 3.06 |
| TPSA | 81.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|