C30H31N3O4S2 — CID 126231926
2-[4-[(Z)-[3-[4-(dimethylamino)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126231926) has the molecular formula C30H31N3O4S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 2-[4-[(Z)-[3-[4-(dimethylamino)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-[3-[4-(dimethylamino)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126231926 |
| Molecular Formula | C30H31N3O4S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 2-[4-[(Z)-[3-[4-(dimethylamino)phenyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxyphenoxy]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(c3ccc(N(C)C)cc3)C2=O)ccc1OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C30H31N3O4S2/c1-6-36-26-16-21(10-15-25(26)37-18-28(34)31-24-9-7-8-19(2)20(24)3)17-27-29(35)33(30(38)39-27)23-13-11-22(12-14-23)32(4)5/h7-17H,6,18H2,1-5H3,(H,31,34)/b27-17- |
| InChIKey | KODGDYPTDPHSGR-PKAZHMFMSA-N |
| XLogP | 6.19 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|