C25H21BrN2O4S — CID 126234126
(5Z)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126234126) has the molecular formula C25H21BrN2O4S and a molecular weight of 525.42 g/mol. Its IUPAC name is (5Z)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126234126 |
| Molecular Formula | C25H21BrN2O4S |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | (5Z)-3-[2-(4-bromophenyl)-2-oxoethyl]-5-[[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(-n2c(C)cc(/C=C3\SC(=O)N(CC(=O)c4ccc(Br)cc4)C3=O)c2C)cc1 |
| InChI | InChI=1S/C25H21BrN2O4S/c1-15-12-18(16(2)28(15)20-8-10-21(32-3)11-9-20)13-23-24(30)27(25(31)33-23)14-22(29)17-4-6-19(26)7-5-17/h4-13H,14H2,1-3H3/b23-13- |
| InChIKey | XPZOUSSSNIKWAA-QRVIBDJDSA-N |
| XLogP | 5.78 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|