C22H25N3 — CID 126234909
N-[4-[(2S)-butan-2-yl]phenyl]-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanimine (PubChem CID 126234909) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[4-[(2S)-butan-2-yl]phenyl]-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanimine.
| Compound Name | N-[4-[(2S)-butan-2-yl]phenyl]-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanimine |
|---|---|
| PubChem CID | 126234909 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-[4-[(2S)-butan-2-yl]phenyl]-1-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methanimine |
| SMILES | CC[C@H](C)c1ccc(/N=C/c2cc(C)n(-c3ccccn3)c2C)cc1 |
| InChI | InChI=1S/C22H25N3/c1-5-16(2)19-9-11-21(12-10-19)24-15-20-14-17(3)25(18(20)4)22-8-6-7-13-23-22/h6-16H,5H2,1-4H3/b24-15+/t16-/m0/s1 |
| InChIKey | CYPRPPMMVKFKCI-WTJYETQFSA-N |
| XLogP | 5.75 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|