C26H21BrN2O3S2 — CID 126234989
N-(4-bromophenyl)-2-[4-[(Z)-[4-oxo-3-[(1R)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126234989) has the molecular formula C26H21BrN2O3S2 and a molecular weight of 553.50 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[4-[(Z)-[4-oxo-3-[(1R)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[4-[(Z)-[4-oxo-3-[(1R)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126234989 |
| Molecular Formula | C26H21BrN2O3S2 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | N-(4-bromophenyl)-2-[4-[(Z)-[4-oxo-3-[(1R)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | C[C@H](c1ccccc1)N1C(=O)/C(=C/c2ccc(OCC(=O)Nc3ccc(Br)cc3)cc2)SC1=S |
| InChI | InChI=1S/C26H21BrN2O3S2/c1-17(19-5-3-2-4-6-19)29-25(31)23(34-26(29)33)15-18-7-13-22(14-8-18)32-16-24(30)28-21-11-9-20(27)10-12-21/h2-15,17H,16H2,1H3,(H,28,30)/b23-15-/t17-/m1/s1 |
| InChIKey | FJPXYJAYYBXVML-XMSCMFJESA-N |
| XLogP | 6.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|