C17H19BrN4O2S — CID 126235669
N-[(Z)-(5-bromo-2-ethoxyphenyl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 126235669) has the molecular formula C17H19BrN4O2S and a molecular weight of 423.34 g/mol. Its IUPAC name is N-[(Z)-(5-bromo-2-ethoxyphenyl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-(5-bromo-2-ethoxyphenyl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 126235669 |
| Molecular Formula | C17H19BrN4O2S |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | N-[(Z)-(5-bromo-2-ethoxyphenyl)methylideneamino]-2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | CCOc1ccc(Br)cc1/C=N\NC(=O)CSc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C17H19BrN4O2S/c1-4-24-15-6-5-14(18)8-13(15)9-19-22-16(23)10-25-17-20-11(2)7-12(3)21-17/h5-9H,4,10H2,1-3H3,(H,22,23)/b19-9- |
| InChIKey | PPECEOOMPAAVDG-OCKHKDLRSA-N |
| XLogP | 3.50 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|