C22H17N5O5 — CID 126236767
(5E)-5-[[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylidene]-1-pyridin-3-yl-1,3-diazinane-2,4,6-trione (PubChem CID 126236767) has the molecular formula C22H17N5O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is (5E)-5-[[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylidene]-1-pyridin-3-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylidene]-1-pyridin-3-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126236767 |
| Molecular Formula | C22H17N5O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | (5E)-5-[[2,5-dimethyl-1-(3-nitrophenyl)pyrrol-3-yl]methylidene]-1-pyridin-3-yl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cc(/C=C2\C(=O)NC(=O)N(c3cccnc3)C2=O)c(C)n1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17N5O5/c1-13-9-15(14(2)25(13)16-5-3-6-17(11-16)27(31)32)10-19-20(28)24-22(30)26(21(19)29)18-7-4-8-23-12-18/h3-12H,1-2H3,(H,24,28,30)/b19-10+ |
| InChIKey | ZNLBCEYGSRHVAD-VXLYETTFSA-N |
| XLogP | 3.06 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|