C21H17ClN2O4 — CID 126237272
(5E)-1-(3-chloro-2-methylphenyl)-5-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126237272) has the molecular formula C21H17ClN2O4 and a molecular weight of 396.83 g/mol. Its IUPAC name is (5E)-1-(3-chloro-2-methylphenyl)-5-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126237272 |
| Molecular Formula | C21H17ClN2O4 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (5E)-1-(3-chloro-2-methylphenyl)-5-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(/C=C/C=C2\C(=O)NC(=O)N(c3cccc(Cl)c3C)C2=O)cc1 |
| InChI | InChI=1S/C21H17ClN2O4/c1-13-17(22)7-4-8-18(13)24-20(26)16(19(25)23-21(24)27)6-3-5-14-9-11-15(28-2)12-10-14/h3-12H,1-2H3,(H,23,25,27)/b5-3+,16-6+ |
| InChIKey | BFLMVVLAMMBMLQ-XPNFCJTCSA-N |
| XLogP | 3.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|