C19H13F3INO3S2 — CID 126237424
(5Z)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one (PubChem CID 126237424) has the molecular formula C19H13F3INO3S2 and a molecular weight of 551.35 g/mol. Its IUPAC name is (5Z)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126237424 |
| Molecular Formula | C19H13F3INO3S2 |
| Molecular Weight | 551.35 g/mol |
| Exact Mass | 550.93 |
| IUPAC Name | (5Z)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc(I)c1O |
| InChI | InChI=1S/C19H13F3INO3S2/c1-2-27-14-7-10(6-13(23)16(14)25)8-15-17(26)24(18(28)29-15)12-5-3-4-11(9-12)19(20,21)22/h3-9,25H,2H2,1H3/b15-8- |
| InChIKey | IZRPXOBKSUVMFP-NVNXTCNLSA-N |
| XLogP | 5.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.35 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|