About diethyl thiolane-2,2-dicarboxylate
diethyl thiolane-2,2-dicarboxylate (PubChem CID 12624304) has the molecular formula C10H16O4S
and a molecular weight of 232.30 g/mol. Its IUPAC name is diethyl thiolane-2,2-dicarboxylate.
Molecular Properties
| Compound Name | diethyl thiolane-2,2-dicarboxylate |
| PubChem CID | 12624304 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | diethyl thiolane-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCS1 |
| InChI | InChI=1S/C10H16O4S/c1-3-13-8(11)10(6-5-7-15-10)9(12)14-4-2/h3-7H2,1-2H3 |
| InChIKey | LMQVEUVASKKJGI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl thiolane-2,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl thiolane-2,2-dicarboxylate?
The IUPAC name of diethyl thiolane-2,2-dicarboxylate (CID 12624304) is diethyl thiolane-2,2-dicarboxylate.
What is the SMILES notation for diethyl thiolane-2,2-dicarboxylate?
The canonical SMILES for diethyl thiolane-2,2-dicarboxylate is CCOC(=O)C1(C(=O)OCC)CCCS1.
What is the InChIKey of diethyl thiolane-2,2-dicarboxylate?
The InChIKey is LMQVEUVASKKJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4S/c1-3-13-8(11)10(6-5-7-15-10)9(12)14-4-2/h3-7H2,1-2H3.
What are the key properties of diethyl thiolane-2,2-dicarboxylate?
diethyl thiolane-2,2-dicarboxylate has a molecular weight of 232.30 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl thiolane-2,2-dicarboxylate is sourced from PubChem (CID 12624304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).