C26H20FN3O — CID 126243302
(4Z)-4-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 126243302) has the molecular formula C26H20FN3O and a molecular weight of 409.46 g/mol. Its IUPAC name is (4Z)-4-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 126243302 |
| Molecular Formula | C26H20FN3O |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (4Z)-4-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1ccc2c(ccn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H20FN3O/c1-18-24(26(31)30(28-18)23-8-3-2-4-9-23)16-19-10-11-25-21(14-19)12-13-29(25)17-20-6-5-7-22(27)15-20/h2-16H,17H2,1H3/b24-16- |
| InChIKey | JBWSZZOASPPWPK-JLPGSUDCSA-N |
| XLogP | 5.63 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|