About (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione
(2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione (PubChem CID 12624379) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione.
Molecular Properties
| Compound Name | (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione |
| PubChem CID | 12624379 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione |
| SMILES | C=CCC/C(C)=C/C(=S)N1CCCC1 |
| InChI | InChI=1S/C12H19NS/c1-3-4-7-11(2)10-12(14)13-8-5-6-9-13/h3,10H,1,4-9H2,2H3/b11-10+ |
| InChIKey | XWCZNDHFVGPOEY-ZHACJKMWSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione?
The IUPAC name of (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione (CID 12624379) is (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione.
What is the SMILES notation for (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione?
The canonical SMILES for (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione is C=CCC/C(C)=C/C(=S)N1CCCC1.
What is the InChIKey of (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione?
The InChIKey is XWCZNDHFVGPOEY-ZHACJKMWSA-N. The full InChI is InChI=1S/C12H19NS/c1-3-4-7-11(2)10-12(14)13-8-5-6-9-13/h3,10H,1,4-9H2,2H3/b11-10+.
What are the key properties of (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione?
(2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione has a molecular weight of 209.36 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3-methyl-1-pyrrolidin-1-ylhepta-2,6-diene-1-thione is sourced from PubChem (CID 12624379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).