About 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol
3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol (PubChem CID 12624459) has the molecular formula C15H33NO2
and a molecular weight of 259.43 g/mol. Its IUPAC name is 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol.
Molecular Properties
| Compound Name | 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol |
| PubChem CID | 12624459 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol |
| SMILES | COCCC(C)CCC(NC(C)(C)C)C(C)(C)O |
| InChI | InChI=1S/C15H33NO2/c1-12(10-11-18-7)8-9-13(15(5,6)17)16-14(2,3)4/h12-13,16-17H,8-11H2,1-7H3 |
| InChIKey | MAHRTELFFIRODZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol?
The IUPAC name of 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol (CID 12624459) is 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol.
What is the SMILES notation for 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol?
The canonical SMILES for 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol is COCCC(C)CCC(NC(C)(C)C)C(C)(C)O.
What is the InChIKey of 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol?
The InChIKey is MAHRTELFFIRODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO2/c1-12(10-11-18-7)8-9-13(15(5,6)17)16-14(2,3)4/h12-13,16-17H,8-11H2,1-7H3.
What are the key properties of 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol?
3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol has a molecular weight of 259.43 g/mol, XLogP of 2.97, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(tert-butylamino)-8-methoxy-2,6-dimethyloctan-2-ol is sourced from PubChem (CID 12624459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).