C28H20ClN5O5S — CID 126246048
(5E)-1-(2-chlorophenyl)-5-[[2,5-dimethyl-1-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126246048) has the molecular formula C28H20ClN5O5S and a molecular weight of 574.02 g/mol. Its IUPAC name is (5E)-1-(2-chlorophenyl)-5-[[2,5-dimethyl-1-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-(2-chlorophenyl)-5-[[2,5-dimethyl-1-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126246048 |
| Molecular Formula | C28H20ClN5O5S |
| Molecular Weight | 574.02 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | (5E)-1-(2-chlorophenyl)-5-[[2,5-dimethyl-1-[4-[(5-nitro-2-pyridinyl)oxy]phenyl]pyrrol-3-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1cc(/C=C2\C(=O)NC(=S)N(c3ccccc3Cl)C2=O)c(C)n1-c1ccc(Oc2ccc([N+](=O)[O-])cn2)cc1 |
| InChI | InChI=1S/C28H20ClN5O5S/c1-16-13-18(14-22-26(35)31-28(40)33(27(22)36)24-6-4-3-5-23(24)29)17(2)32(16)19-7-10-21(11-8-19)39-25-12-9-20(15-30-25)34(37)38/h3-15H,1-2H3,(H,31,35,40)/b22-14+ |
| InChIKey | RDHUUSMXLLYVNO-HYARGMPZSA-N |
| XLogP | 5.67 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.02 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|