C27H24N2O3S2 — CID 126246820
N-(3,4-dimethylphenyl)-2-[(5Z)-5-[[4-(4-methylphenyl)sulfanylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126246820) has the molecular formula C27H24N2O3S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[(5Z)-5-[[4-(4-methylphenyl)sulfanylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[(5Z)-5-[[4-(4-methylphenyl)sulfanylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126246820 |
| Molecular Formula | C27H24N2O3S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[(5Z)-5-[[4-(4-methylphenyl)sulfanylphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1ccc(Sc2ccc(/C=C3\SC(=O)N(CC(=O)Nc4ccc(C)c(C)c4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O3S2/c1-17-4-10-22(11-5-17)33-23-12-7-20(8-13-23)15-24-26(31)29(27(32)34-24)16-25(30)28-21-9-6-18(2)19(3)14-21/h4-15H,16H2,1-3H3,(H,28,30)/b24-15- |
| InChIKey | QUDSOLDRBLNAFN-IWIPYMOSSA-N |
| XLogP | 6.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|