C23H32N2O6S — CID 126247258
2-[4-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]phenoxy]-N-[(2R)-pentan-2-yl]acetamide (PubChem CID 126247258) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is 2-[4-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]phenoxy]-N-[(2R)-pentan-2-yl]acetamide.
| Compound Name | 2-[4-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]phenoxy]-N-[(2R)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 126247258 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[4-[2-(3,4-dimethoxyphenyl)ethylsulfamoyl]phenoxy]-N-[(2R)-pentan-2-yl]acetamide |
| SMILES | CCC[C@@H](C)NC(=O)COc1ccc(S(=O)(=O)NCCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H32N2O6S/c1-5-6-17(2)25-23(26)16-31-19-8-10-20(11-9-19)32(27,28)24-14-13-18-7-12-21(29-3)22(15-18)30-4/h7-12,15,17,24H,5-6,13-14,16H2,1-4H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | NDMHRSNVKBOURG-QGZVFWFLSA-N |
| XLogP | 2.91 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |