C26H20BrClN2O4S — CID 126248278
2-[(5E)-5-[[3-bromo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 126248278) has the molecular formula C26H20BrClN2O4S and a molecular weight of 571.88 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126248278 |
| Molecular Formula | C26H20BrClN2O4S |
| Molecular Weight | 571.88 g/mol |
| Exact Mass | 570.00 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | Cc1cccc(COc2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccccc4Cl)C3=O)cc2Br)c1 |
| InChI | InChI=1S/C26H20BrClN2O4S/c1-16-5-4-6-18(11-16)15-34-22-10-9-17(12-19(22)27)13-23-25(32)30(26(33)35-23)14-24(31)29-21-8-3-2-7-20(21)28/h2-13H,14-15H2,1H3,(H,29,31)/b23-13+ |
| InChIKey | LTHKOFBKCCHZLA-YDZHTSKRSA-N |
| XLogP | 6.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.88 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|