About (2-fluorophenyl)methyl 2-acetamidobenzoate
(2-fluorophenyl)methyl 2-acetamidobenzoate (PubChem CID 1262491) has the molecular formula C16H14FNO3
and a molecular weight of 287.29 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-acetamidobenzoate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 2-acetamidobenzoate |
| PubChem CID | 1262491 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (2-fluorophenyl)methyl 2-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccccc1C(=O)OCc1ccccc1F |
| InChI | InChI=1S/C16H14FNO3/c1-11(19)18-15-9-5-3-7-13(15)16(20)21-10-12-6-2-4-8-14(12)17/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | DLGVMMATQDABHM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluorophenyl)methyl 2-acetamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 2-acetamidobenzoate?
The IUPAC name of (2-fluorophenyl)methyl 2-acetamidobenzoate (CID 1262491) is (2-fluorophenyl)methyl 2-acetamidobenzoate.
What is the SMILES notation for (2-fluorophenyl)methyl 2-acetamidobenzoate?
The canonical SMILES for (2-fluorophenyl)methyl 2-acetamidobenzoate is CC(=O)Nc1ccccc1C(=O)OCc1ccccc1F.
What is the InChIKey of (2-fluorophenyl)methyl 2-acetamidobenzoate?
The InChIKey is DLGVMMATQDABHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO3/c1-11(19)18-15-9-5-3-7-13(15)16(20)21-10-12-6-2-4-8-14(12)17/h2-9H,10H2,1H3,(H,18,19).
What are the key properties of (2-fluorophenyl)methyl 2-acetamidobenzoate?
(2-fluorophenyl)methyl 2-acetamidobenzoate has a molecular weight of 287.29 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 2-acetamidobenzoate is sourced from PubChem (CID 1262491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).