C22H26ClN3O2S — CID 126251330
2-[2-chloro-4-(4-methylpiperazine-1-carbothioyl)phenoxy]-N-(4-ethylphenyl)acetamide (PubChem CID 126251330) has the molecular formula C22H26ClN3O2S and a molecular weight of 431.99 g/mol. Its IUPAC name is 2-[2-chloro-4-(4-methylpiperazine-1-carbothioyl)phenoxy]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(4-methylpiperazine-1-carbothioyl)phenoxy]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126251330 |
| Molecular Formula | C22H26ClN3O2S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 2-[2-chloro-4-(4-methylpiperazine-1-carbothioyl)phenoxy]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)COc2ccc(C(=S)N3CCN(C)CC3)cc2Cl)cc1 |
| InChI | InChI=1S/C22H26ClN3O2S/c1-3-16-4-7-18(8-5-16)24-21(27)15-28-20-9-6-17(14-19(20)23)22(29)26-12-10-25(2)11-13-26/h4-9,14H,3,10-13,15H2,1-2H3,(H,24,27) |
| InChIKey | OCJQMAJAJYQFLG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|