C26H27ClN4O2 — CID 126252226
(5E)-3-(4-chlorophenyl)-5-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126252226) has the molecular formula C26H27ClN4O2 and a molecular weight of 462.98 g/mol. Its IUPAC name is (5E)-3-(4-chlorophenyl)-5-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(4-chlorophenyl)-5-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126252226 |
| Molecular Formula | C26H27ClN4O2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (5E)-3-(4-chlorophenyl)-5-[[1-[4-(diethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(-n2c(C)cc(/C=C3/NC(=O)N(c4ccc(Cl)cc4)C3=O)c2C)cc1 |
| InChI | InChI=1S/C26H27ClN4O2/c1-5-29(6-2)21-11-13-22(14-12-21)30-17(3)15-19(18(30)4)16-24-25(32)31(26(33)28-24)23-9-7-20(27)8-10-23/h7-16H,5-6H2,1-4H3,(H,28,33)/b24-16+ |
| InChIKey | DCCZPYZELICUFJ-LFVJCYFKSA-N |
| XLogP | 5.69 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|