About Tropylium azide
Tropylium azide (PubChem CID 12625269) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 7-azidocyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | Tropylium azide |
| PubChem CID | 12625269 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 7-azidocyclohepta-1,3,5-triene |
| SMILES | C1=CC=CC(C=C1)N=[N+]=[N-] |
| InChI | InChI=1S/C7H7N3/c8-10-9-7-5-3-1-2-4-6-7/h1-7H |
| InChIKey | HXCINKBJVNOSMK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 14.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 215 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze Tropylium azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tropylium azide?
The IUPAC name of Tropylium azide (CID 12625269) is 7-azidocyclohepta-1,3,5-triene.
What is the SMILES notation for Tropylium azide?
The canonical SMILES for Tropylium azide is C1=CC=CC(C=C1)N=[N+]=[N-].
What is the InChIKey of Tropylium azide?
The InChIKey is HXCINKBJVNOSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c8-10-9-7-5-3-1-2-4-6-7/h1-7H.
What are the key properties of Tropylium azide?
Tropylium azide has a molecular weight of 133.15 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Tropylium azide is sourced from PubChem (CID 12625269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).