C17H15ClIN3O4 — CID 126254737
N-[(E)-[4-(2-amino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-4-chlorobenzamide (PubChem CID 126254737) has the molecular formula C17H15ClIN3O4 and a molecular weight of 487.68 g/mol. Its IUPAC name is N-[(E)-[4-(2-amino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-4-chlorobenzamide.
| Compound Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-4-chlorobenzamide |
|---|---|
| PubChem CID | 126254737 |
| Molecular Formula | C17H15ClIN3O4 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | N-[(E)-[4-(2-amino-2-oxoethoxy)-3-iodo-5-methoxyphenyl]methylideneamino]-4-chlorobenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc(Cl)cc2)cc(I)c1OCC(N)=O |
| InChI | InChI=1S/C17H15ClIN3O4/c1-25-14-7-10(6-13(19)16(14)26-9-15(20)23)8-21-22-17(24)11-2-4-12(18)5-3-11/h2-8H,9H2,1H3,(H2,20,23)(H,22,24)/b21-8+ |
| InChIKey | DTDQWGKGWWYYAJ-ODCIPOBUSA-N |
| XLogP | 2.58 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|