C25H21N3OS — CID 126255017
N-[(E)-[4-(4-methylphenyl)sulfanylphenyl]methylideneamino]-3-pyrrol-1-ylbenzamide (PubChem CID 126255017) has the molecular formula C25H21N3OS and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[(E)-[4-(4-methylphenyl)sulfanylphenyl]methylideneamino]-3-pyrrol-1-ylbenzamide.
| Compound Name | N-[(E)-[4-(4-methylphenyl)sulfanylphenyl]methylideneamino]-3-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 126255017 |
| Molecular Formula | C25H21N3OS |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[(E)-[4-(4-methylphenyl)sulfanylphenyl]methylideneamino]-3-pyrrol-1-ylbenzamide |
| SMILES | Cc1ccc(Sc2ccc(/C=N/NC(=O)c3cccc(-n4cccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C25H21N3OS/c1-19-7-11-23(12-8-19)30-24-13-9-20(10-14-24)18-26-27-25(29)21-5-4-6-22(17-21)28-15-2-3-16-28/h2-18H,1H3,(H,27,29)/b26-18+ |
| InChIKey | RMRIQHGSGNSRAW-NLRVBDNBSA-N |
| XLogP | 5.70 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|