C25H27BrN2O3 — CID 126256661
2-[2-bromo-6-ethoxy-4-[(4-methylanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126256661) has the molecular formula C25H27BrN2O3 and a molecular weight of 483.41 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(4-methylanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(4-methylanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126256661 |
| Molecular Formula | C25H27BrN2O3 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(4-methylanilino)methyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCOc1cc(CNc2ccc(C)cc2)cc(Br)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C25H27BrN2O3/c1-4-30-23-14-19(15-27-20-10-8-17(2)9-11-20)13-22(26)25(23)31-16-24(29)28-21-7-5-6-18(3)12-21/h5-14,27H,4,15-16H2,1-3H3,(H,28,29) |
| InChIKey | MHJTVSXMGGHVBZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |