C28H27FN2O3 — CID 126257026
(Z)-2-cyano-3-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126257026) has the molecular formula C28H27FN2O3 and a molecular weight of 458.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126257026 |
| Molecular Formula | C28H27FN2O3 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (Z)-2-cyano-3-[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)ccc1OCc1ccccc1F |
| InChI | InChI=1S/C28H27FN2O3/c1-2-33-27-18-22(14-15-26(27)34-20-23-12-6-7-13-25(23)29)17-24(19-30)28(32)31-16-8-11-21-9-4-3-5-10-21/h3-7,9-10,12-15,17-18H,2,8,11,16,20H2,1H3,(H,31,32)/b24-17- |
| InChIKey | YKNBLYQOJNMXJW-ULJHMMPZSA-N |
| XLogP | 5.46 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|