About 2-ethoxy-4-methylpenta-1,4-diene
2-ethoxy-4-methylpenta-1,4-diene (PubChem CID 12625765) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-ethoxy-4-methylpenta-1,4-diene.
Molecular Properties
| Compound Name | 2-ethoxy-4-methylpenta-1,4-diene |
| PubChem CID | 12625765 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 2-ethoxy-4-methylpenta-1,4-diene |
| SMILES | C=C(C)CC(=C)OCC |
| InChI | InChI=1S/C8H14O/c1-5-9-8(4)6-7(2)3/h2,4-6H2,1,3H3 |
| InChIKey | DHTFXSACIOVHMN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-4-methylpenta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4-methylpenta-1,4-diene?
The IUPAC name of 2-ethoxy-4-methylpenta-1,4-diene (CID 12625765) is 2-ethoxy-4-methylpenta-1,4-diene.
What is the SMILES notation for 2-ethoxy-4-methylpenta-1,4-diene?
The canonical SMILES for 2-ethoxy-4-methylpenta-1,4-diene is C=C(C)CC(=C)OCC.
What is the InChIKey of 2-ethoxy-4-methylpenta-1,4-diene?
The InChIKey is DHTFXSACIOVHMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-5-9-8(4)6-7(2)3/h2,4-6H2,1,3H3.
What are the key properties of 2-ethoxy-4-methylpenta-1,4-diene?
2-ethoxy-4-methylpenta-1,4-diene has a molecular weight of 126.20 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-methylpenta-1,4-diene is sourced from PubChem (CID 12625765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).