About (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol
(E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol (PubChem CID 12625783) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol.
Molecular Properties
| Compound Name | (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol |
| PubChem CID | 12625783 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol |
| SMILES | C/C(=C\CC(C)(C)O)CN1CCCCC1 |
| InChI | InChI=1S/C13H25NO/c1-12(7-8-13(2,3)15)11-14-9-5-4-6-10-14/h7,15H,4-6,8-11H2,1-3H3/b12-7+ |
| InChIKey | MIEBZDOYEJQNCL-KPKJPENVSA-N |
| XLogP | 2.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol?
The IUPAC name of (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol (CID 12625783) is (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol.
What is the SMILES notation for (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol?
The canonical SMILES for (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol is C/C(=C\CC(C)(C)O)CN1CCCCC1.
What is the InChIKey of (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol?
The InChIKey is MIEBZDOYEJQNCL-KPKJPENVSA-N. The full InChI is InChI=1S/C13H25NO/c1-12(7-8-13(2,3)15)11-14-9-5-4-6-10-14/h7,15H,4-6,8-11H2,1-3H3/b12-7+.
What are the key properties of (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol?
(E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol has a molecular weight of 211.35 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,5-dimethyl-6-piperidin-1-ylhex-4-en-2-ol is sourced from PubChem (CID 12625783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).