C28H26ClN3O3 — CID 126260876
(Z)-3-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide (PubChem CID 126260876) has the molecular formula C28H26ClN3O3 and a molecular weight of 487.99 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126260876 |
| Molecular Formula | C28H26ClN3O3 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (Z)-3-[3-chloro-4-[2-(2,4-dimethylanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(2,3-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=C(/C#N)C(=O)Nc3cccc(C)c3C)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C28H26ClN3O3/c1-17-8-10-24(19(3)12-17)31-27(33)16-35-26-11-9-21(14-23(26)29)13-22(15-30)28(34)32-25-7-5-6-18(2)20(25)4/h5-14H,16H2,1-4H3,(H,31,33)(H,32,34)/b22-13- |
| InChIKey | FLHDACSVGKUKEH-XKZIYDEJSA-N |
| XLogP | 6.14 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|