C25H30N4O5 — CID 126261219
N-(4-butoxyphenyl)-N'-[(Z)-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide (PubChem CID 126261219) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-N'-[(Z)-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide.
| Compound Name | N-(4-butoxyphenyl)-N'-[(Z)-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126261219 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-(4-butoxyphenyl)-N'-[(Z)-[4-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
| SMILES | CCCCOc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H30N4O5/c1-2-3-16-33-21-12-8-20(9-13-21)27-24(31)25(32)28-26-17-19-6-10-22(11-7-19)34-18-23(30)29-14-4-5-15-29/h6-13,17H,2-5,14-16,18H2,1H3,(H,27,31)(H,28,32)/b26-17- |
| InChIKey | GVOKRLBUULPUKH-ONUIUJJFSA-N |
| XLogP | 2.96 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|