About dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate
dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 1262617) has the molecular formula C24H23NO7
and a molecular weight of 437.45 g/mol. Its IUPAC name is dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 1262617 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(N2C=C(C(=O)OC)C(c3cccc(O)c3)C(C(=O)OC)=C2)cc1 |
| InChI | InChI=1S/C24H23NO7/c1-4-32-22(27)15-8-10-17(11-9-15)25-13-19(23(28)30-2)21(20(14-25)24(29)31-3)16-6-5-7-18(26)12-16/h5-14,21,26H,4H2,1-3H3 |
| InChIKey | BHYNERLVQXOGPR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate (CID 1262617) is dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate is CCOC(=O)c1ccc(N2C=C(C(=O)OC)C(c3cccc(O)c3)C(C(=O)OC)=C2)cc1.
What is the InChIKey of dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate?
The InChIKey is BHYNERLVQXOGPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO7/c1-4-32-22(27)15-8-10-17(11-9-15)25-13-19(23(28)30-2)21(20(14-25)24(29)31-3)16-6-5-7-18(26)12-16/h5-14,21,26H,4H2,1-3H3.
What are the key properties of dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate?
dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate has a molecular weight of 437.45 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-(4-ethoxycarbonylphenyl)-4-(3-hydroxyphenyl)-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 1262617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).