C29H32N4O4 — CID 126263849
N'-[(Z)-[4-[2-(2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide (PubChem CID 126263849) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-(2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide.
| Compound Name | N'-[(Z)-[4-[2-(2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 126263849 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | N'-[(Z)-[4-[2-(2,6-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-[(4-propan-2-ylphenyl)methyl]oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)COc1ccc(/C=N\NC(=O)C(=O)NCc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H32N4O4/c1-19(2)24-12-8-22(9-13-24)16-30-28(35)29(36)33-31-17-23-10-14-25(15-11-23)37-18-26(34)32-27-20(3)6-5-7-21(27)4/h5-15,17,19H,16,18H2,1-4H3,(H,30,35)(H,32,34)(H,33,36)/b31-17- |
| InChIKey | UEKQULKQMXEIOH-LJUMEUDFSA-N |
| XLogP | 4.21 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|