C21H23FN4O4 — CID 126264504
N-[(2S)-butan-2-yl]-N'-[(Z)-[3-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126264504) has the molecular formula C21H23FN4O4 and a molecular weight of 414.44 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-N'-[(Z)-[3-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[3-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126264504 |
| Molecular Formula | C21H23FN4O4 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[(2S)-butan-2-yl]-N'-[(Z)-[3-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | CC[C@H](C)NC(=O)C(=O)N/N=C\c1cccc(OCC(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H23FN4O4/c1-3-14(2)24-20(28)21(29)26-23-12-15-5-4-6-18(11-15)30-13-19(27)25-17-9-7-16(22)8-10-17/h4-12,14H,3,13H2,1-2H3,(H,24,28)(H,25,27)(H,26,29)/b23-12-/t14-/m0/s1 |
| InChIKey | UMHHOLNRJQPNAF-IIHGDPFSSA-N |
| XLogP | 2.21 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|