C7H8N2O2 — CID 12626468
2,5-dimethyl-3-nitropyridine (PubChem CID 12626468) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 2,5-dimethyl-3-nitropyridine.
| Compound Name | 2,5-dimethyl-3-nitropyridine |
|---|---|
| PubChem CID | 12626468 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2,5-dimethyl-3-nitropyridine |
| SMILES | Cc1cnc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H8N2O2/c1-5-3-7(9(10)11)6(2)8-4-5/h3-4H,1-2H3 |
| InChIKey | ODTIWFKSSFPXNI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|