C25H23FN4O6 — CID 126265377
N-(2-fluorophenyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126265377) has the molecular formula C25H23FN4O6 and a molecular weight of 494.48 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(2-fluorophenyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126265377 |
| Molecular Formula | C25H23FN4O6 |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-(2-fluorophenyl)-N'-[(Z)-[3-methoxy-4-[2-(3-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | COc1cccc(NC(=O)COc2ccc(/C=N\NC(=O)C(=O)Nc3ccccc3F)cc2OC)c1 |
| InChI | InChI=1S/C25H23FN4O6/c1-34-18-7-5-6-17(13-18)28-23(31)15-36-21-11-10-16(12-22(21)35-2)14-27-30-25(33)24(32)29-20-9-4-3-8-19(20)26/h3-14H,15H2,1-2H3,(H,28,31)(H,29,32)(H,30,33)/b27-14- |
| InChIKey | XYRPWMWLCAYBDI-VYYCAZPPSA-N |
| XLogP | 2.95 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|