About N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide
N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide (PubChem CID 1262685) has the molecular formula C20H20N4O3S
and a molecular weight of 396.47 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide |
| PubChem CID | 1262685 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide |
| SMILES | COc1cccc(NC(=O)Cc2nnc(SCC(=O)c3ccccc3)n2C)c1 |
| InChI | InChI=1S/C20H20N4O3S/c1-24-18(12-19(26)21-15-9-6-10-16(11-15)27-2)22-23-20(24)28-13-17(25)14-7-4-3-5-8-14/h3-11H,12-13H2,1-2H3,(H,21,26) |
| InChIKey | YTPADNBBXOIFMD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide?
The IUPAC name of N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide (CID 1262685) is N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide.
What is the SMILES notation for N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide?
The canonical SMILES for N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide is COc1cccc(NC(=O)Cc2nnc(SCC(=O)c3ccccc3)n2C)c1.
What is the InChIKey of N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide?
The InChIKey is YTPADNBBXOIFMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3S/c1-24-18(12-19(26)21-15-9-6-10-16(11-15)27-2)22-23-20(24)28-13-17(25)14-7-4-3-5-8-14/h3-11H,12-13H2,1-2H3,(H,21,26).
What are the key properties of N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide?
N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide has a molecular weight of 396.47 g/mol, XLogP of 2.98, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxyphenyl)-2-(4-methyl-5-phenacylsulfanyl-1,2,4-triazol-3-yl)acetamide is sourced from PubChem (CID 1262685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).