C6H2ClF7O2 — CID 12626925
(Z)-6-chloro-2,2,3,3,4,4,5-heptafluorohex-5-enoic acid (PubChem CID 12626925) has the molecular formula C6H2ClF7O2 and a molecular weight of 274.52 g/mol. Its IUPAC name is (Z)-6-chloro-2,2,3,3,4,4,5-heptafluorohex-5-enoic acid.
| Compound Name | (Z)-6-chloro-2,2,3,3,4,4,5-heptafluorohex-5-enoic acid |
|---|---|
| PubChem CID | 12626925 |
| Molecular Formula | C6H2ClF7O2 |
| Molecular Weight | 274.52 g/mol |
| Exact Mass | 273.96 |
| IUPAC Name | (Z)-6-chloro-2,2,3,3,4,4,5-heptafluorohex-5-enoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)/C(F)=C/Cl |
| InChI | InChI=1S/C6H2ClF7O2/c7-1-2(8)4(9,10)6(13,14)5(11,12)3(15)16/h1H,(H,15,16)/b2-1- |
| InChIKey | XWLDSYLJRKQNDC-UPHRSURJSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|